| Identification | |
| Name: | 9-Octadecenamide,N-(2-hydroxyethyl)-, (9Z)- |
| Synonyms: | 9-Octadecenamide,N-(2-hydroxyethyl)-, (Z)-;Oleamide, N-(2-hydroxyethyl)- (6CI,7CI,8CI);AM3101;N-(2-Hydroxyethyl)oleamide;N-Oleoyl-2-aminoethanol;N-Oleoylethanolamine;Oleamide MEA;Oleic acid ethanolamide;Oleic acidmonoethanolamide;Oleoylethanolamide; |
| CAS: | 111-58-0 |
| EINECS: | 203-884-8 |
| Molecular Formula: | C20H39NO2 |
| Molecular Weight: | 325.52916 |
| InChI: | InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 50-60ºC |
| Density: | 0.915 g/cm3 |
| Refractive index: | 1.473 |
| Water Solubility: | Soluble in DMSO (>25 mg/ml) and ethanol (>25 mg/ml) |
| Solubility: | Soluble in DMSO (>25 mg/ml) and ethanol (>25 mg/ml) |
| Appearance: | white to off-white solid |
| Specification: |
N-(2-Hydroxyethyl)-9-octadecenamide , its CAS NO. is 111-58-0, the synonyms are 9-Octadecenamide, N-(2-hydroxyethyl)- ; Monoethanolamine oleic acid amide ; N-(2-Hydroxyethyl)oleamide ; N-Oleoylethanolamine ; Oleamide MEA ; Oleoyl monoethanolamide . |
| Biological Activity: | Lipid mediator and analog of anandamide (N-(2-Hydroxyethyl)-5Z,8Z,11Z,14Z-eicosatetraenamide ) that is involved in peripheral regulation of feeding. Selective GPR55 agonist (EC 50 values are 0.44, >30 and >30 μ M at GPR55, CB 1 and CB 2 respectively) and PPAR α agonist (EC 50 = 120 nM). Induces satiety through activation of PPAR α and is also a ceramidase inhibitor. Also endogenous agonist at the GPR119 receptor. |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
