| Identification | |
| Name: | 2-Nonenoic acid, methylester |
| Synonyms: | NSC 76416;Neofolione; |
| CAS: | 111-79-5 |
| EINECS: | 203-908-7 |
| Molecular Formula: | C10H18O2 |
| Molecular Weight: | 170.25 |
| InChI: | InChI=1/C10H18O2/c1-3-4-5-6-7-8-9-10(11)12-2/h8-9H,3-7H2,1-2H3/b9-8+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Flash Point: | 196? |
| Density: | 0.895 |
| Refractive index: | 1.444 |
| Appearance: | Colorless to slightly yellow liquid |
| Specification: | Safety Statements:26-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 196? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
 |
|
