| Identification | |
| Name: | Dodecanoic acid, methylester |
| Synonyms: | Agnique ME 1270U;Agnique ME 1290;CE 1290;Lauricacid, methyl ester (6CI,8CI);CE1295;Edenor ME-C 1298-100;Emery 2296;Metholene 2296;Methyl dodecanoate;Methyl dodecylate;Methyl laurinate;Methyl n-dodecanoate;NSC5027;Pastel M 12;Pastell M 12;Stepan C 40;Texaprint SDM 100;Uniphat A 40; |
| CAS: | 111-82-0 |
| EINECS: | 203-911-3 CH3(CH2)10COOCH3 |
| Molecular Formula: | C13H26O2 |
| Molecular Weight: | 214.3472 |
| InChI: | InChI=1/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | GEN |
| Flash Point: | 94 |
| Density: | 0.8702 |
| Refractive index: | n20/D 1.432 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble Appearance:Clear liquid Transport Information: GEN Hazard Symbols:UN NO. particular:particular |
| Appearance: | Clear liquid |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 94 |
| Storage Temperature: | 2-8°C |
| Color: | COLORLESS LIQUID Water-white liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
