Identification |
Name: | Dodecanoic acid, methylester |
Synonyms: | Agnique ME 1270U;Agnique ME 1290;CE 1290;Lauricacid, methyl ester (6CI,8CI);CE1295;Edenor ME-C 1298-100;Emery 2296;Metholene 2296;Methyl dodecanoate;Methyl dodecylate;Methyl laurinate;Methyl n-dodecanoate;NSC5027;Pastel M 12;Pastell M 12;Stepan C 40;Texaprint SDM 100;Uniphat A 40; |
CAS: | 111-82-0 |
EINECS: | 203-911-3
CH3(CH2)10COOCH3 |
Molecular Formula: | C13H26O2 |
Molecular Weight: | 214.3472 |
InChI: | InChI=1/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3-12H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | GEN |
Flash Point: | 94 |
Density: | 0.8702 |
Refractive index: | n20/D 1.432 |
Water Solubility: | Insoluble |
Solubility: | Insoluble Appearance:Clear liquid Transport Information: GEN Hazard Symbols:UN NO. particular:particular
|
Appearance: | Clear liquid |
Specification: | clear colorless to slightly yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 94 |
Storage Temperature: | 2-8°C |
Color: | COLORLESS LIQUID Water-white liquid |
Safety Data |
Hazard Symbols |
|
|
 |