Identification |
Name: | Enniatin |
Synonyms: | ENNIATIN FROM MICROBIAL SOURCE;Enniatin microbial |
CAS: | 11113-62-5 |
Molecular Formula: | C36H63N3O9.C35H61N3O9.C34H59N3O9.C33H57N3O9 |
Molecular Weight: | 0 |
InChI: | InChI=1/C33H57N3O9/c1-16(2)22-31(40)43-26(20(9)10)29(38)35(14)24(18(5)6)33(42)45-27(21(11)12)30(39)36(15)23(17(3)4)32(41)44-25(19(7)8)28(37)34(22)13/h16-27H,1-15H3/t22-,23-,24-,25?,26?,27?/m0/s1 |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Flash Point: | 454°C |
Boiling Point: | 827°Cat760mmHg |
Density: | 1.036g/cm3 |
Refractive index: | 1.459 |
Specification: | Safety Statements:22-36/37/39-45 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Packinggroup: | I |
Flash Point: | 454°C |
Storage Temperature: | 2-8°C |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
 |