| Identification |
| Name: | 3-Bromopyruvic acid |
| Synonyms: | Bromopyruvic acid |
| CAS: | 1113-59-3 |
| EINECS: | 214-206-5 |
| Molecular Formula: | C3H3BrO3 |
| Molecular Weight: | 166.96 |
| InChI: | InChI=1/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 326 |
| Density: | 2.011 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.521 |
| Solubility: | Very soluble |
| Appearance: | white to pale yellow crystalline powder |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Usage: | Being studied as a potential treatment for certain types of cancer. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
