Identification |
Name: | 3-Bromopyruvic acid |
Synonyms: | Bromopyruvic acid |
CAS: | 1113-59-3 |
EINECS: | 214-206-5 |
Molecular Formula: | C3H3BrO3 |
Molecular Weight: | 166.96 |
InChI: | InChI=1/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
Molecular Structure: |
 |
Properties |
Transport: | 326 |
Density: | 2.011 g/cm3 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.521 |
Solubility: | Very soluble |
Appearance: | white to pale yellow crystalline powder |
Packinggroup: | II |
Storage Temperature: | 2-8°C |
Usage: | Being studied as a potential treatment for certain types of cancer. |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |