| Identification | |
| Name: | 4,4-Diethoxy-N,N-dimethyl-1-butanamine |
| Synonyms: | Butyraldehyde,4-(dimethylamino)-, diethyl acetal (7CI,8CI);4,4-Diethoxy-N,N-dimethylbutanamine;4-(Dimethylamino)butanal diethyl acetal; |
| CAS: | 1116-77-4 |
| Molecular Formula: | C10H23NO2 |
| Molecular Weight: | 189.3 |
| InChI: | InChI=1/C10H23NO2/c1-5-12-10(13-6-2)8-7-9-11(3)4/h10H,5-9H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158? |
| Density: | 0.884 |
| Refractive index: | 1.421 |
| Appearance: | Colorless to light-yellowish lucent liquid |
| Specification: |
? 4,4-Diethoxy-N,N-dimethyl-1-butanamine , with CAS number of 1116-77-4, can be called 1-butanamine, 4,4-diethoxy-N,N-dimethyl- ; (4,4-Diethoxy-butyl)-dimethyl-amine ; N,N-Dimethyl-4-aminobutanal diethyl acetal . |
| Flash Point: | 158? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
