| Identification | |
| Name: | 5,9,13-Pentadecatrien-2-one,6,10,14-trimethyl-, (5E,9E)- |
| Synonyms: | 5,9,13-Pentadecatrien-2-one,6,10,14-trimethyl-, (E,E)- (8CI);(E,E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one;E,E-Farnesylacetone; |
| CAS: | 1117-52-8 |
| EINECS: | 214-246-3 |
| Molecular Formula: | C18H30O |
| Molecular Weight: | 262.43 |
| InChI: | InChI=1/C18H30O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,13H,6-8,10,12,14H2,1-5H3/b16-11+,17-13+ |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.481 |
| Specification: |
The Farnesyl acetone is an organic compound with the formula C18H30O. The IUPAC name of this chemical is (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one. With the CAS registry number 1117-52-8, it is also named as 5,9,13-pentadecatrien-2-one, 6,10,14-trimethyl-. Physical properties about Farnesyl acetone are: (1)ACD/LogP: 6.16; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6.16; (4)ACD/LogD (pH 7.4): 6.16; (5)ACD/BCF (pH 5.5): 28486.55; (6)ACD/BCF (pH 7.4): 28486.55; (7)ACD/KOC (pH 5.5): 53729.9; (8)ACD/KOC (pH 7.4): 53729.9; (9)#H bond acceptors: 1; (10)#Freely Rotating Bonds: 9; (11)Polar Surface Area: 17.07 Å2; (12)Index of Refraction: 1.474; (13)Molar Refractivity: 85.17 cm3; (14)Molar Volume: 303 cm3; (15)Polarizability: 33.76×10-24cm3; (16)Surface Tension: 29 dyne/cm; (17)Density: 0.866 g/cm3; (18)Flash Point: 140.4 °C; (19)Enthalpy of Vaporization: 62 kJ/mol; (20)Boiling Point: 372.8 °C at 760 mmHg; (21)Vapour Pressure: 9.39E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
