| Identification |
| Name: | 1,3-Cyclopentanedicarboxylicacid, 1-amino-, (1S,3R)- |
| Synonyms: | 1,3-Cyclopentanedicarboxylicacid, 1-amino-, (1S-cis)-;(1S,3R)-1-Amino-1,3-cyclopentanedicarboxylic acid;(1S,3R)-ACPD;1-Amino-trans-1,3-cyclopentanedicarboxylic acid;1-Amino-trans-1,3-dicarboxycyclopentane;1-Aminocyclopentane-1S,3R-dicarboxylicacid;ACPD;cis-1-Amino-1,3-dicarboxycyclopentane;trans-ACPD;149881-50-5; |
| CAS: | 111900-32-4 |
| Molecular Formula: | C7H11 N O4 |
| Molecular Weight: | 173.16654 |
| InChI: | InChI=1/C7H11NO4/c8-7(6(11)12)2-1-4(3-7)5(9)10/h4H,1-3,8H2,(H,9,10)(H,11,12)/t4-,7+/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 167.1°C |
| Boiling Point: | 352.7°Cat760mmHg |
| Density: | 1.452g/cm3 |
| Refractive index: | 1.563 |
| Biological Activity: | Active isomer of (±)-trans-ACPD ((?-1-Aminocyclopentane-trans-1,3-dicarboxylic acid ). Agonist at both group I and II mGlu receptors (EC 50 values are 5, 15, 42 and 60 μ M at mGluR 2 , mGluR 5 , mGluR 1 and mGluR 6 respectively). |
| Flash Point: | 167.1°C |
| Color: | white |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
