| Identification | |
| Name: | Lauroyl chloride |
| Synonyms: | Dodecanoyl chloride; n-Dodecanoyl Chloride |
| CAS: | 112-16-3 |
| EINECS: | 203-941-7 |
| Molecular Formula: | C12H23ClO |
| Molecular Weight: | 218.77 |
| InChI: | InChI=1/C12H23ClO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Density: | 0.946 |
| Stability: | Stable. Incompatible with strong oxidizing agents, amines, strong bases. Do not allow to come into contact with water or moisture. |
| Refractive index: | 1.444-1.446 |
| Water Solubility: | reacts |
| Solubility: | Insoluble |
| Appearance: | colourless to light yellow liquid |
| Specification: |
Dodecanoyl chloride , its cas register number is 112-16-3. It also can be called AI3-52409 ; Dodecanoic acid, chloride ; HSDB 5567 ; Lauric acid chloride ; Lauroyl chloride ; n-Dodecanoyl chloride . It is a colourless to light yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Color: | WATER-WHITE LIQUID |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
