| Identification | |
| Name: | 10-Undecen-1-ol,1-acetate |
| Synonyms: | 10-Undecen-1-ol,acetate (6CI,7CI,8CI,9CI); 1-Acetoxyundec-10-ene; 1-Undecen-11-yl acetate;10-Undecen-1-yl acetate; 10-Undecenyl acetate; 11-Acetoxyundecene; AcetateC-11; NSC 525 |
| CAS: | 112-19-6 |
| EINECS: | 203-944-3 |
| Molecular Formula: | C13H24 O2 |
| Molecular Weight: | 212.37 |
| InChI: | InChI=1/C13H24O2/c1-3-4-5-6-7-8-9-10-11-12-15-13(2)14/h3H,1,4-12H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.5°C |
| Boiling Point: | 261°Cat760mmHg |
| Density: | 0.878g/cm3 |
| Refractive index: | 1.44 |
| Specification: |
Undecenyl acetate ,its cas register number is 112-19-6. It also can be called 10-Undecen-1-ol, acetate ; Undec-10-enyl acetate ; and 10-Undecen-1-ol, 1-acetate . |
| Report: |
Undecenyl acetate (CAS NO.112-19-6) has been reported in EPA TSCA Inventory. |
| Flash Point: | 106.5°C |
| Safety Data | |
 |
|
