| Identification | |
| Name: | Myristoyl chloride |
| Synonyms: | Tetradecanoyl chloride; Myristoylchloride; 98%; Myristyl Chloride |
| CAS: | 112-64-1 |
| EINECS: | 203-994-6 |
| Molecular Formula: | C14H27ClO |
| Molecular Weight: | 246.82 |
| InChI: | InChI=1/C14H27ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Density: | 0.908 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.448-1.45 |
| Water Solubility: | MAY DECOMPOSE |
| Solubility: | MAY DECOMPOSE with water |
| Appearance: | COLORLESS LIQUID |
| Specification: |
Myristoyl chloride (112-64-1) is a kind of acid chlorides with appearance of clear colorless to light yellowish-brown liquid. It is also called for n-Tetradecanoyl chloride ; Tetradecanoyl chloride ; Myristoyl chloride 99+% ; Myristoyl chloride 98% ; Myristoyl chloride 98+% . |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
