| Identification |
| Name: | N,N-dimethylhexadecylamine |
| Synonyms: | N,N-Dimethyl-n-hexadecylamine; hexadecyldimethylamine; Armeen DM 16D; Hexadecyl dimethyl amine |
| CAS: | 112-69-6 |
| EINECS: | 203-997-2 |
| Molecular Formula: | C18H39N |
| Molecular Weight: | 269.51 |
| InChI: | InChI=1/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Melting Point: | 12 |
| Flash Point: | STABILITY |
| Boiling Point: | 0.801 |
| Density: | 0.801 |
| Stability: | No data. |
| Refractive index: | 1.444 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Flash Point: | STABILITY |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Barlene(R) tertiary amines are used as chemical intermediates for the manufacture of quaternary ammonium compounds, amine oxide and betaine surfactants |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
