| Identification | ||
| Name: | 1-Tetradecanamine,N,N-dimethyl- | |
| Synonyms: | AT 1495;Adma 14;Armeen DM 14D;Dimethylmyristamine;Dimethylmyristylamine;Dimethyltetradecylamine;Farmin DM4098;Genamin 14R302D;IPL 30;Myristyldimethylamine;N,N-Dimethyl-1-tetradecanamine;N,N-Dimethyl-N-tetradecylamine;N,N-Dimethylmyristylamine;N-Tetradecyldimethylamine;NSC 78319;Tetradecyldimethylamine;Tetradecylamine,N,N-dimethyl- (6CI,7CI,8CI); | |
| CAS: | 112-75-4 | |
| EINECS: | 204-002-4 | |
| Molecular Formula: | C16H35N | |
| Molecular Weight: | 241.46 | |
| InChI: | InChI=1/C16H35N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3/h4-16H2,1-3H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2735 | |
| Flash Point: | STABILITY | |
| Boiling Point: | 0.797 | |
| Density: | 0.795 | |
| Stability: | Acid-stable. | |
| Refractive index: | 1.441 | |
| Water Solubility: | AUTOIGNITION | |
| Solubility: | AUTOIGNITION | |
| Appearance: | clear liquid | |
| Specification: | Liquid usageEng:Barlene(R) tertiary amines are used as chemical intermediates for the manufacture of quaternary ammonium compounds, amine oxide and betaine surfactants Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) | |
| Flash Point: | STABILITY | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Color: | LIQUID | |
| Usage: | Barlene(R) tertiary amines are used as chemical intermediates for the manufacture of quaternary ammonium compounds, amine oxide and betaine surfactants | |
| Safety Data | ||
| Hazard Symbols |
C:Corrosive
|
|
 |
||
