| Identification | |
| Name: | Stearyl chloride |
| Synonyms: | Octadecanoyl chloride |
| CAS: | 112-76-5 |
| EINECS: | 204-004-5 |
| Molecular Formula: | C18H35ClO |
| Molecular Weight: | 302.93 |
| InChI: | InChI=1/C18H35ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 0.9 |
| Stability: | No data. |
| Refractive index: | n20/D 1.454(lit.) |
| Water Solubility: | hydrolysis |
| Solubility: | Decomposes |
| Appearance: | yellow to reddish liquid |
| Packinggroup: | III |
| Storage Temperature: | −20°C |
| Color: | strongly brown |
| Usage: | Prepn of substituted amines and amides, acid anhydrides, esterification of alcohols, synthesis of other organic compound. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
