| Identification |
| Name: | Methanone,dicyclopropyl- |
| Synonyms: | Dicyclopropylmethanone;NSC 49148;Cyclopropylketone (6CI,7CI,8CI); |
| CAS: | 1121-37-5 |
| EINECS: | 214-331-5 |
| Molecular Formula: | C7H10O |
| Molecular Weight: | 110.15 |
| InChI: | InChI=1/C7H10O/c8-7(5-1-2-5)6-3-4-6/h5-6H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1224 |
| Density: | 0.977 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.466-1.469 |
| Solubility: | Soluble |
| Appearance: | Clear colorless to very faint yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29142900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data |
| Hazard Symbols |
F: Flammable
|
| |
 |
