| Identification |
| Name: | Benzene,1-fluoro-3-iodo- |
| Synonyms: | 1-Fluoro-3-iodobenzene;1-Iodo-3-fluorobenzene;3-Fluoro-1-iodobenzene;3-Fluorophenyl iodide;3-Iodofluorobenzene;NSC 10279;m-Fluoroiodobenzene;m-Fluorophenyl iodide;m-Iodofluorobenzene;m-Iodophenyl fluoride; |
| CAS: | 1121-86-4 |
| EINECS: | 214-339-9 |
| Molecular Formula: | C6H4FI |
| Molecular Weight: | 222 |
| InChI: | InChI=1/C6H4FI/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -42°C |
| Density: | 1.89 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Light sensitive. |
| Refractive index: | 1.583-1.585 |
| Solubility: | Insoluble |
| Appearance: | Clear yellow liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
