| Identification | |
| Name: | Glutarimide |
| Synonyms: | Glutarimide(6CI,7CI,8CI);NSC 168666;NSC 58190;2,6-Piperidinedione; |
| CAS: | 1121-89-7 |
| EINECS: | 214-340-4 |
| Molecular Formula: | C5H7NO2 |
| Molecular Weight: | 113.11 |
| InChI: | InChI=1/C5H7NO2/c7-4-2-1-3-5(8)6-4/h1-3H2,(H,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.3°C |
| Boiling Point: | 288°Cat760mmHg |
| Density: | 1.184g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.47 |
| Solubility: | Very soluble |
| Appearance: | White solid. |
| Specification: |
Glutarimide , its cas register number is 1121-89-7. It also can be called 2,6-Piperidinedione ; 2,6-Piperidinedione (9CI) .It is a white crystalline powder.Also it is a chemical compound featuring a piperidine ring with two ketones attached next to the nitrogen. |
| Flash Point: | 152.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
