| Identification | |
| Name: | Acetamide,2-[(R)-(diphenylmethyl)sulfinyl]- |
| Synonyms: | (-)-Modafinil;(R)-(-)-Modafinil; Armodafinil; CEP 10952; CRL 40982; R-(-)-Modafinil |
| CAS: | 112111-43-0 |
| Molecular Formula: | C15H15 N O2 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 156-1580C |
| Density: | 1.283g/cm3 |
| Refractive index: | 1.645 |
| Solubility: | Practically insoluble in water and cyclohexane. Sparingly to slightly soluble in methanol and acetone. In water, 170.1 mg/L at 25 deg C (est) |
| Appearance: | White solid |
| Color: | White to off-white crystalline powder |
| Usage: | Used for treatment of excessive sleepiness, a1-adrenoceptor agonist |
| Safety Data | |
 |
|
