| Identification | |
| Name: | 4-Dimethylaminopyridine |
| Synonyms: | 4 dimethylamino pyridine; N,N-Dimethyl-4-pyridinamine; 4-(Dimethylamino)pyridine; p-Dimethylaminopyridine; gamma-(Dimethylamino)pyridine; 4-Dimethyl amino pyridine; 4-(dimethylamino)-pyridin; 4-Dimethylaminepyridine; N,N-Dimethyl-4-aminopyridine; n,n-dimethyl-4-pyridinamin; Pyridine, 4-(dimethylamino)-; AURORA KA-6495; 26DCLPY; 2,6-DICHLOROPYRIDINE; AKOS BBS-00004314; 4-(Dimethylamino)pyridine, 99%, prilled; 4-(DIMETHYLAMINO)PYRIDINE SOLUTION; 4-(Dimethylamino)pyridine, ReagentPlus, 99%; N,N'-DIMEHTYL-4-PYRIDINAMINE; 4-(Dimethylamino) PyridineForSynthesis; 4-N,N-Dimethylaminopyridine; N,N-dimethylpyridin-4-amine; DMAP; 4-dimethylamino pyridine |
| CAS: | 1122-58-3 |
| EINECS: | 214-353-5 |
| Molecular Formula: | C7H10N2 |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C7H10N2/c1-9(2)7-3-5-8-6-4-7/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760/2811 |
| Density: | 1.012 g/cm3 |
| Stability: | Stable. Incompatible with acids, oxidizing agents. |
| Refractive index: | n20/D 1.431 |
| Solubility: | Miscible |
| Appearance: | white to yellow crystalline powder |
| Packinggroup: | II |
| HS Code: | 29333999 |
| Storage Temperature: | Store in dark! |
| Color: | off-white to yellow |
| Usage: | A highly fluorescent adenosine analogue, which in a dimethoxytrityl, phosphoramidite protected form, can be site-specifically inserted into oligonucleotides through a 3?5?phosphodiester linkage using an automated DNA synthesizer |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
