| Identification | |
| Name: | Cyclohexane, nitro- |
| Synonyms: | NSC 66277;Nitrocyclohexane |
| CAS: | 1122-60-7 |
| EINECS: | 214-354-0 |
| Molecular Formula: | C6H11 N O2 |
| Molecular Weight: | 129.18 |
| InChI: | InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3382 6.1/PG 1 |
| Melting Point: | −34 °C(lit.) |
| Flash Point: | 81.2°C |
| Boiling Point: | 205.5-206 °C768 mm Hg(lit.) |
| Density: | 1.05g/cm3 |
| Refractive index: | n20/D 1.462(lit.) |
| Solubility: | Sol in alcohol, ligroin |
| Specification: |
General Description about Nitrocyclohexane (CAS NO.1122-60-7) , it is a colorless liquid. It highly flammable with water.Also, it range from slight to strong oxidizing agents. If mixed with reducing agents, including hydrides, sulfides and nitrides, they may begin a vigorous reaction that culminates in a detonation. Nitroalkanes are milder oxidizing agents, but still react violently with reducing agents at higher temperature and pressures. Nitroalkanes react with inorganic bases to form explosive salts. The presence of metal oxides increases the thermal sensitivity of nitroalkanes. Nitroalkanes with more than one nitro group are generally explosive. Nitroalkanes are insoluble in water. Flammable/combustible material. May be ignited by heat, sparks or flames. |
| Report: |
EPA Extremely Hazardous Substances List. |
| Packinggroup: | III |
| Flash Point: | 81.2°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
