| Identification | |
| Name: | 2-Acetylpyridine |
| Synonyms: | FEMA 3251;2-Acetopyridine;1-(2-Pyridinyl)ethanone;Ethanone, 1-(2-pyridinyl)-;1-pyridin-2-ylethanone;Methyl 2-pyridyl ketone;Ketone, methyl 2-pyridyl;2-Acetylpyridine (natural);2-Pyridyl methyl ketone;2-Acetyl pyridine;Acetyl Pyridine; |
| CAS: | 1122-62-9 |
| EINECS: | 214-355-6 |
| Molecular Formula: | C7H7NO |
| Molecular Weight: | 121.13 |
| InChI: | InChI=1/C7H7NO/c1-6(9)7-4-2-3-5-8-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08 |
| Stability: | No data. |
| Refractive index: | 1.52-1.522 |
| Solubility: | Soluble |
| Appearance: | clear colorless to slightly brown liquid |
| Specification: |
?2-Acetylpyridine (CAS NO.1122-62-9), its Synonyms are 1-(2-Pyridinyl)ethanone ; 2-Acetylpyridine (natural) ; 2-Pyridyl methyl ketone ; Ketone, methyl 2-pyridyl ; Methyl 2-pyridyl ketone ; Ethanone, 1-(2-pyridinyl)- . |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
