| Identification |
| Name: | Benzaldehyde,4-bromo- |
| Synonyms: | Benzaldehyde,p-bromo- (6CI,8CI);1-Bromo-4-formylbenzene;4-Formylbromobenzene;4-Formylphenyl bromide;NSC 21638;p-Bromobenzaldehyde; |
| CAS: | 1122-91-4 |
| EINECS: | 214-365-0 |
| Molecular Formula: | C7H5BrO |
| Molecular Weight: | 185.02 |
| InChI: | InChI=1/C7H5BrO/c8-7-3-1-6(5-9)2-4-7/h1-5H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.577 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.547 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble |
| Appearance: | white to cream crystals |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. Store protected from light. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
