| Identification |
| Name: | Pyridine, 4-methoxy-,1-oxide |
| Synonyms: | 4-Methoxypyridine1-oxide;4-Methoxypyridine oxide;NSC 27964;p-Methoxypyridine N-oxide; |
| CAS: | 1122-96-9 |
| EINECS: | 214-367-1 |
| Molecular Formula: | C6H7NO2 |
| Molecular Weight: | 125.13 |
| InChI: | InChI=1/C6H7NO2/c1-9-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.09 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Hygroscopic: absorbs moisture or water from the air. |
| Solubility: | Very soluble |
| Appearance: | White to yellowish solid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
