| Identification | |
| Name: | 2-Cyclohexen-1-one,3,5-dimethyl- |
| Synonyms: | 3,5-Dimethyl-2-cyclohexen-1-one;NSC 10113; NSC 845 |
| CAS: | 1123-09-7 |
| EINECS: | 214-369-2 |
| Molecular Formula: | C8H12 O |
| Molecular Weight: | 124.18 |
| InChI: | InChI=1/C8H12O/c1-6-3-7(2)5-8(9)4-6/h4,7H,3,5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.881 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.482-1.484 |
| Solubility: | Slightly soluble |
| Appearance: | Clear colorless to very faint yellow liquid. Ketone odor. |
| Specification: |
3,5-Dimethyl-2-cyclohexen-1-one (CAS No.1123-09-7), its synonyms are 2-Cyclohexen-1-one, 3,5-dimethyl- ; 3,5-Dimethylcyclohex-2-en-1-one . |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
