| Identification | |
| Name: | Phenol,4-chloro-2,6-dimethyl- |
| Synonyms: | NSC 5785;2,6-Xylenol,4-chloro- (6CI,7CI,8CI);2,6-Dimethyl-4-chlorophenol;4-Chloro-2,6-dimethylphenol;4-Chloro-2,6-xylenol; |
| CAS: | 1123-63-3 |
| EINECS: | 214-376-0 |
| Molecular Formula: | C8H9ClO |
| Molecular Weight: | 156.6092 |
| InChI: | InChI=1S/C8H9ClO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 80 - 83 C |
| Density: | 1.183 g/cm3 |
| Refractive index: | 1.558 |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble
Appearance:white to off-white crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | white to off-white crystalline powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
