Identification |
Name: | Phenol,4-chloro-2,6-dimethyl- |
Synonyms: | NSC 5785;2,6-Xylenol,4-chloro- (6CI,7CI,8CI);2,6-Dimethyl-4-chlorophenol;4-Chloro-2,6-dimethylphenol;4-Chloro-2,6-xylenol; |
CAS: | 1123-63-3 |
EINECS: | 214-376-0 |
Molecular Formula: | C8H9ClO |
Molecular Weight: | 156.6092 |
InChI: | InChI=1S/C8H9ClO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Melting Point: | 80 - 83 C
|
Density: | 1.183 g/cm3 |
Refractive index: | 1.558 |
Water Solubility: | Slightly soluble |
Solubility: | Slightly soluble
Appearance:white to off-white crystalline powder Transport Information:25kgs Hazard Symbols:UN
NO.
|
Appearance: | white to off-white crystalline powder |
Safety Data |
Hazard Symbols |
|
|
 |