| Identification | |
| Name: | Benzaldehyde Dimethylacetal |
| Synonyms: | Benzaldehyde,dimethyl acetal (6CI,7CI,8CI); (Dimethoxymethyl)benzene;Dimethoxyphenylmethane; NSC 286137; Phenyldimethoxymethane; a,a-Dimethoxytoluene; a-Methoxybenzyl methyl ether |
| CAS: | 1125-88-8 |
| EINECS: | 214-413-0 |
| Molecular Formula: | C9H12O2 |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C9H12O2/c1-10-9(11-2)8-6-4-3-5-7-8/h3-7,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3271 |
| Melting Point: | 87-89 C |
| Density: | 1.014 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.492-1.494 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | colorless liquid. |
| Specification: |
Benzaldehyde dimethyl acetal (1125-88-8) also can be called Alpha,alpha-dimethoxytoluene ; .Alpha.,.alpha.-Dimethoxytoluene ; (dimethoxymethyl)benzene ; Toluene, .alpha.,.alpha.-dimethoxy- ; benzene, (dimethoxymethyl)- .Its first aid measures and others should be known.Such as: When on the skin: should flush skin with plenty of water immediatelyfor at least 15 minutes while removing contaminated clothing. Or in the eyes: Flush eyes with plenty of water for at least 15 minutes, occasionally lifting the upper and lower eyelids. While ,it's Inhaled: Remove from exposure and move to fresh air immediately.Then you have the ingesting of the product : Wash mouth out with water. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29110000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
