| Identification | |
| Name: | Pyridinium,1-(2-hydrazinyl-2-oxoethyl)-, chloride (1:1) |
| Synonyms: | 1-(Carboxymethyl)pyridiniumchloride, hydrazide (6CI,7CI); Pyridinium, 1-(2-hydrazino-2-oxoethyl)-,chloride (9CI); Pyridinium, 1-(carboxymethyl)-, chloride, hydrazide (8CI);1-(2-Hydrazino-2-oxoethyl)pyridinium chloride; Girard-P reagent; Girard's Preagent; Pyridinioacetohydrazide chloride; Reagents, Girard's P |
| CAS: | 1126-58-5 |
| EINECS: | 214-421-4 |
| Molecular Formula: | C7H10 N3 O . Cl |
| Molecular Weight: | 187.63 |
| InChI: | InChI=1/C7H9N3O.ClH/c8-9-7(11)6-10-4-2-1-3-5-10;/h1-5H,6,8H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 201-203 °C (dec.)(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | Clear brown-yellow to brown-red liquid |
| Specification: |
The cas register number of Girard's Reagent P is 1126-58-5. It also can be called as Pyridinium, 1-(2-hydrazino-2-oxoethyl)-, chloride and the Systematic name about this chemical is 2-pyridin-1-ium-1-ylacetohydrazide chloride. Physical properties about Girard's Reagent P are: (1)ACD/LogP: -5.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -5.31; (4)ACD/LogD (pH 7.4): -5.31; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 27.43Å2. Uses of Girard's Reagent P: 1-hydrazinocarbonylmethyl-pyridinium and 4-nitro-benzaldehyde reacts with diazomethane to get 1-[(4-nitro-benzylidenehydrazinocarbonyl)-methyl]-pyridinium. This reaction needs solvent ethanol. The yield is 67 %. People can use the following data to convert to the molecule structure. |
| Flash Point: | °C |
| Safety Data | |
 |
|
