| Identification | |
| Name: | 8-Quinolinol, N-oxide |
| Synonyms: | 8-Hydroxyquinoline1-oxide;8-Hydroxyquinoline N-oxide;8-Quinolinol N-oxide;NSC 21656;o-Hydroxyquinoline N-oxide; |
| CAS: | 1127-45-3 |
| EINECS: | 214-430-3 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c11-8-5-1-3-7-4-2-6-10(12)9(7)8/h1-6,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 139 ºC |
| Boiling Point: | 267 ºC |
| Density: | 1.28 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. However, may decompose if exposed to moist air or water. |
| Refractive index: | 1.627 |
| Solubility: | Very soluble |
| Appearance: | light yellow crystals |
| Specification: |
8-Quinolinol, N-oxide , its cas register number is 1127-45-3. It also can be called 5-21-03-00276 (Beilstein Handbook Reference) ; 8-Hydroxyquinoline 1-oxide ; 8-Hydroxyquinoline N-oxide ; 8-Hydroxyquinoline-N-oxide ; BRN 0128737 ; CCRIS 4451 ; EINECS 214-430-3 ; NSC 21656 ; o-Hydroxyquinoline N-oxide ; 8-Hydroxyquinoline-N-oxide ; Quinolin-8-ol 1-oxide .It is a yellow crystalline solid. |
| Flash Point: | 139 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Usage: | A quinoline derivative; shows mutagenic activity |
| Safety Data | |
 |
|
