| Identification | |
| Name: | Letrozole |
| Synonyms: | 4,4-(1H-1,2,4-Triazol-1-ylmethylene)dibenzonitrile;4,4'-(1H-1,2,4-Triazol-1-ylmethylene)bisbenzonitrile;Benzonitrile,4,4'-(1H-1,2,4-triazol-1-ylmethylene) bis-;Benzonitrile, 4,4-(1H-1,2,4-triazol-1-ylmethylene)bis-;Femara (TN);Femara;Letrozole [USAN:INN];4,4'-(1H-1,2,4-triazol-1-ylmethylene) bis-Benzonitrile;Letrozole & int;CGS 20267;CGS-20267;Lelrozol;4-[1-(1,2,4-Triazolyl)-methyl]-Benzonitrile;4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile; |
| CAS: | 112809-51-5 |
| Molecular Formula: | C17H11N5 |
| Molecular Weight: | 285.31 |
| InChI: | InChI=1/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21g/cm3 |
| Solubility: | Insoluble |
| Appearance: | white to off-whitecrystalline powder |
| Storage Temperature: | Store in original container in a cool dark place. |
| Color: | White to yellowish crystalline powder |
| Usage: | A nonsteroidal aromatase inhibitor structurally related to Fadrozole. Antineoplastic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
