Identification |
Name: | 3-Methoxy-2,4,5-trifluorobenzoic acid |
Synonyms: | 2,4,5-trifluoro-3-methoxy-benzoate;3-Methoxy-2,4,5-trifluorobenzoid acid; |
CAS: | 11281-65-5 |
Molecular Formula: | C8H5F3O3 |
Molecular Weight: | 206.1187 |
InChI: | InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13)/p-1 |
Molecular Structure: |
 |
Properties |
Density: | 1.487 g/cm3 |
Appearance: | white to light yellow crystal powder |
Specification: | white to light yellow crystal powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |