| Identification | |
| Name: | 2-hydroxyethanaminium 4-oxo-4-(phenylamino)butanoate |
| Synonyms: | Succinanilic acid compd. with 2-aminoethanol (1:1);2-hydroxyethanaminium 4-oxo-4-(phenylamino)butanoate;4-Oxo-4-(phenylamino)butanoic acid compd. with 2-aminoethanol (1:1);BUTANOIC ACID, 4-OXO-4-(PHENYLAMINO)-, compd. with 2-AMINOETHANOL (1:1);112997-59-8;AC1L1TIW;AC1Q5NBH;LS-46388;4-anilino-4-oxobutanoate; 2-hydroxyethylazanium |
| CAS: | 112997-59-8 |
| Molecular Formula: | C12H18N2O4 |
| Molecular Weight: | 254.2823 |
| InChI: | InChI=1/C10H11NO3.C2H7NO/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8;3-1-2-4/h1-5H,6-7H2,(H,11,12)(H,13,14);4H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 233.4°C |
| Boiling Point: | 462.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 233.4°C |
| Safety Data | |
 |
|
