| Identification | |
| Name: | 5H-Dibenz[b,f]azepine-5-propanamine,10,11-dihydro-N,N-dimethyl-, hydrochloride (1:1) |
| Synonyms: | N-(g-Dimethylaminopropyl)iminodibenzyl hydrochloride;Praminil;Presamine;Promiben;SK-Pramine;Surplix;Tipramine;Tofranil;Tofranile;5H-Dibenz[b,f]azepine,5-[3-(dimethylamino)propyl]-10,11-dihydro-, monohydrochloride (8CI);Eupramin;Feinalmin;Imavate;Imidol;Imilanyle;Imipramine monohydrochloride;Imiprin;Imizinum;Iramil;Chrytemin;Censtim;Censtin;Apo-Imipramine;5-(3-Dimethylaminopropyl)-10,11-dihydro-5H-dibenz[b,f]azepine hydrochloride;Dyna-Zina;N-(3-Dimethylaminopropyl)iminodibenzylhydrochloride;Melipramine hydrochloride; |
| CAS: | 113-52-0 |
| EINECS: | 204-030-7 |
| Molecular Formula: | C19H25ClN2 |
| Molecular Weight: | 316.87 |
| InChI: | InChI=1/C19H24N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-11H,7,12-15H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Melting Point: | 168-1700C |
| Flash Point: | 179.7°C |
| Boiling Point: | 403.1°Cat760mmHg |
| Density: | 1.041g/cm3 |
| Solubility: | In water, 18.2 mg/l @ 24 deg C. |
| Appearance: | UN 1230 3/PG 2 |
| Specification: | White Solid usageEng:Tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter Safety Statements:7-16-24-33-45-36-26 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 24:Avoid contact with skin 33:Take precautionary measures against static discharges 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 179.7°C |
| Color: | white |
| Usage: | Tricyclic antidepressant; inhibits the serotonin and norepinephrine transporters. Has little effect on the dopamine transporter |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
