| Identification | |
| Name: | 1H-Inden-1-one,2,3-dihydro-2-iodo- |
| Synonyms: | 2-Iodoindanone; |
| CAS: | 113021-30-0 |
| Molecular Formula: | C9H7IO |
| Molecular Weight: | 258.06 |
| InChI: | InChI=1/C9H7IO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 67-69 ºC |
| Density: | 1.87 |
| Refractive index: | 1.671 |
| Specification: |
The cas register number of 2-Iodo-1-indanone is 113021-30-0. It also can be called as 2,3-Dihydro-2-iodo-1H-inden-1-one and the Systematic name about this chemical is 2-iodo-2,3-dihydro-1H-inden-1-one. Physical properties about 2-Iodo-1-indanone are: (1)ACD/LogP: 2.80; (2)ACD/LogD (pH 5.5): 2.8; (3)ACD/LogD (pH 7.4): 2.8; (4)ACD/BCF (pH 5.5): 79.04; (5)ACD/BCF (pH 7.4): 79.04; (6)ACD/KOC (pH 5.5): 794.47; (7)ACD/KOC (pH 7.4): 794.47; (8)#H bond acceptors: 1; (9)Polar Surface Area: 17.07Å2; (10)Index of Refraction: 1.671; (11)Molar Refractivity: 51.61 cm3; (12)Molar Volume: 137.9 cm3; (13)Polarizability: 20.46x10-24cm3; (14)Surface Tension: 52.6 dyne/cm; (15)Enthalpy of Vaporization: 55.05 kJ/mol; (16)Boiling Point: 309.7 °C at 760 mmHg; (17)Vapour Pressure: 0.00063 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
