| Identification | |
| Name: | 4H-1-Benzopyran-4-one,7-fluoro-2,3-dihydro- |
| Synonyms: | 7-Fluoro-2,3-dihydro-4H-chromen-4-one;7-Fluoro-2,3-dihydrochroman-4-one; |
| CAS: | 113209-68-0 |
| Molecular Formula: | C9H7FO2 |
| Molecular Weight: | 166.15 |
| InChI: | InChI=1/C9H7FO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120.5°C |
| Boiling Point: | 281.9°C at 760 mmHg |
| Density: | 1.297g/cm3 |
| Refractive index: | 1.539 |
| Specification: |
4H-1-Benzopyran-4-one,7-fluoro-2,3-dihydro- , its cas register number is 113209-68-0. It also can be called 7-Fluoro-2,3-dihydro-4H-chromen-4-one ; 7-Fluoro-4-chromanone . 4H-1-Benzopyran-4-one,7-fluoro-2,3-dihydro- (CAS NO.113209-68-0) is irritating to eyes, respiratory system and skin. |
| Flash Point: | 120.5°C |
| Safety Data | |
 |
|
