| Identification | |
| Name: | Cycloate |
| Synonyms: | Carbamothioicacid, cyclohexylethyl-, S-ethyl ester (9CI); Cyclohexanecarbamic acid,N-ethylthio-, S-ethyl ester (7CI,8CI); Buranit; Cycloate; EthylN-cyclohexyl-N-ethylthiolcarbamate; Etsan; Eurex; Hexylthiocarbam; R 2063;Ro-Neet; Ro-Neet 6E; Roneet 72LE; Ronit; S-EthylN-cyclohexyl-N-ethylthiocarbamate; S-Ethyl N-cyclohexyl-N-ethylthiolcarbamate;S-Ethyl cyclohexylethylthiocarbamate;S-Ethyl-N-ethyl-N-cyclohexylthiolcarbamate; Sabet |
| CAS: | 1134-23-2 |
| EINECS: | 214-482-7 |
| Molecular Formula: | C11H21 N O S |
| Molecular Weight: | 215.356 |
| InChI: | InChI=1S/C11H21NOS/c1-3-12(11(13)14-4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Melting Point: | 11.5 |
| Density: | 1.02 g/cm3 |
| Water Solubility: | Solubility in water: Not soluble in water. Readily forms an emulsion. |
| Solubility: | Solubility in water: Not soluble in water. Readily forms an emulsion. |
| Appearance: | Amber Liquid |
| Specification: |
It is a thiocarbamate ester. Flammable gases are generated by the combination of thiocarbamates and dithiocarbamates with aldehydes, nitrides, and hydrides. Thiocarbamates and dithiocarbamates are incompatible with acids, peroxides, and acid halides. |
| Storage Temperature: | 0-6°C |
| Color: | Colorless liquid Oily |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
