| Identification |
| Name: | Baclofen |
| Synonyms: | (+/-)-beta(Aminomethyl)-4-chlorobenzenepropanoic acid, Lioresal; 4-amino-3-(4-chlorophenyl)butyric acid; Atrofen; beta-(4-chlorophenyl)gaba; beta-(4-chlorophenyl)-gamma-aminobutyric acid; ba 34647; baclon; beta-(aminomethyl)-4-chlorobenzenepropanoic acid; beta-(aminomethyl)-p-chlorohydrocinnamic acid; c 34647ba; ciba 34,647-ba; Lioresal; gamma-amino-beta-(p-chlorophenyl)butyric acid |
| CAS: | 1134-47-0 |
| EINECS: | 214-486-9 |
| Molecular Formula: | C10H12ClNO2 |
| Molecular Weight: | 213.66 |
| InChI: | InChI=1/C10H12ClNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Melting Point: | 208-210ºC |
| Flash Point: | 174.1ºC |
| Boiling Point: | 364.3ºC at 760 mmHg |
| Density: | 1.285 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.576 |
| Water Solubility: | 1 M HCl: 50 mg/mL |
| Solubility: | 1 M HCl: 50 mg/mL |
| Appearance: | white to very faintly yellow solid |
| Packinggroup: | III |
| Biological Activity: | Selective GABA B receptor agonist. Skeletal muscle relaxant. |
| Flash Point: | 174.1ºC |
| Storage Temperature: | 2-8°C |
| Color: | white to very faintly yellow |
| Usage: | Specific GABA-B receptor agonist. Muscle relaxant (skeletal) |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
