| Identification |
| Name: | 2-phenylthioaniline |
| Synonyms: | 2-(Phenylthio)aniline |
| CAS: | 1134-94-7 |
| EINECS: | 413-030-8 |
| Molecular Formula: | C12H11NS |
| Molecular Weight: | 201.29 |
| InChI: | InChI=1/C12H11NS/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9H,13H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 |
| Flash Point: | 175 °C |
| Boiling Point: | 258 °C / 100mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.675 |
| Appearance: | Kind of white to yellow powder |
| Flash Point: | 175 °C |
| Color: | gray-brown |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
| |
 |
