Identification |
Name: | 2-phenylthioaniline |
Synonyms: | 2-(Phenylthio)aniline |
CAS: | 1134-94-7 |
EINECS: | 413-030-8 |
Molecular Formula: | C12H11NS |
Molecular Weight: | 201.29 |
InChI: | InChI=1/C12H11NS/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9H,13H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3077 |
Flash Point: | 175 °C |
Boiling Point: | 258 °C / 100mmHg |
Density: | 1.19g/cm3 |
Refractive index: | 1.675 |
Appearance: | Kind of white to yellow powder |
Flash Point: | 175 °C |
Color: | gray-brown |
Safety Data |
Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
|
 |