| Identification | |
| Name: | 4-Hydroxy-3-methoxycinnamic acid |
| Synonyms: | Ferulic acid |
| CAS: | 1135-24-6 |
| EINECS: | 214-490-0 |
| Molecular Formula: | C10H10O4 |
| Molecular Weight: | 194.19 |
| InChI: | InChI=1/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.316 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Pale Yellow Solid |
| Specification: |
??4-Hydroxy-3-methoxycinnamic acid ,?its cas register number is 1135-24-6. It also can be called?3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid ; 3-Methoxy-4-hydroxycinnamic acid ; 4-Hydroxy-3-methoxy cinnamic acid ; CCRIS 3256 ; Cinnamic acid, 4-hydroxy-3-methoxy- ; Coniferic acid ; Ferulic acid . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | slightly yellow |
| Usage: | Widely distributed in small amounts in plants. Used as an antioxidant and food preservative |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
