Identification |
Name: | 1,3,2-Dioxaborolane,2,2'-[1,2-ethanediylbis(oxy)]bis- |
Synonyms: | Ethyleneborate (6CI,7CI); Ethylene glycol, cyclic ester with boric acid (H3BO3)ethylene ester (2:1) (8CI); Ethylene borate ([(C2H4O2)BO]2(C2H4)) |
CAS: | 1135-51-9 |
EINECS: | 214-493-7 |
Molecular Formula: | C6H12 B2 O6 |
Molecular Weight: | 201.7779 |
InChI: | InChI=1/C6H12B2O6/c1-2-10-7(9-1)13-5-6-14-8-11-3-4-12-8/h1-6H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 51.9°C |
Boiling Point: | 162.2°Cat760mmHg |
Density: | 1.16g/cm3 |
Refractive index: | 1.414 |
Flash Point: | 51.9°C |
Safety Data |
|
 |