Identification |
Name: | 8-Azaspiro[4.5]decane-7,9-dione,8-[4-[[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]amino]butyl]- |
CAS: | 113777-33-6 |
Molecular Formula: | C22H30 N2 O4 |
Molecular Weight: | 422.95 |
InChI: | InChI=1/C22H30N2O4/c25-20-13-22(9-3-4-10-22)14-21(26)24(20)12-6-5-11-23-15-17-16-27-18-7-1-2-8-19(18)28-17/h1-2,7-8,17,23H,3-6,9-16H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 303.7°C |
Boiling Point: | 578.6°Cat760mmHg |
Density: | 1.22g/cm3 |
Refractive index: | 1.585 |
Biological Activity: | A potent ligand at 5-HT 1A receptors, with mixed agonist and antagonist properties. An agonist at post-synaptic 5-HT 1A receptors. |
Flash Point: | 303.7°C |
Safety Data |
|
|