| Identification | |
| Name: | b-L-erythro-Pentofuranose,2-deoxy- |
| Synonyms: | 2-Deoxy-beta-L-erythro-pentofuranose; |
| CAS: | 113890-38-3 |
| Molecular Formula: | C5H10O4 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C5H10O4/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.453 g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
The CAS register number of 2-Deoxy-beta-L-erythro-pentofuranose is 113890-38-3. It also can be called as b-L-erythro-Pentofuranose,2-deoxy- and the systematic name about this chemical is 2-deoxy-β-L-erythro-pentofuranose. Physical properties about 2-Deoxy-beta-L-erythro-pentofuranose are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 4.06; (4)ACD/KOC (pH 7.4): 4.06; (5)#H bond acceptors: 4; (6)#H bond donors: 3; (7)#Freely Rotating Bonds: 4; (8)Polar Surface Area: 69.92Å2; (9)Index of Refraction: 1.551; (10)Molar Refractivity: 29.46 cm3; (11)Molar Volume: 92.3 cm3; (12)Polarizability: 11.67x10-24cm3; (13)Surface Tension: 62.2 dyne/cm; (14)Enthalpy of Vaporization: 70.49 kJ/mol; (15)Boiling Point: 363 °C at 760 mmHg; (16)Vapour Pressure: 9.74E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
