| Identification | |
| Name: | Propoxur |
| Synonyms: | 2-ISOPROPOXYPHENYL METHYLCARBAMATE; 2-(1-methylethoxy)phenol methylcarbamate; 2-(1-methylethoxy)phenyl methylcarbamate; o-Isopropoxyphenyl Methylcarbamate; o-isopropoxyphenyl N-methylcarbamate; aprocarb; BAY 39007; BAY 9010; Baygon; BAYGON [N-METHYL-2-ISOPROPOXYPHENYLCARBAMATE]; Blattanex; Blattosep; Bolfo; Chemagro 9010; DMS 33; IMPC; Invisi-gard; Isocarb; Isopropoxyphenyl methylcarbamate; Methyl-2-isopropoxyphenylcarbamate; Methylcarbamic acid, o-isopropoxyphenol ester; PHC; Phenol, o-isopropoxy-, methylcarbamate; Pillargon; Propotox; Propyon; Sendran; Suncide; Tendex; Tugon fliegenkugel; Unden |
| CAS: | 114-26-1 |
| EINECS: | 204-043-8 |
| Molecular Formula: | C11H15NO3 |
| Molecular Weight: | 209.24 |
| InChI: | InChI=1/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811/2588 |
| Density: | 1.082g/cm3 |
| Refractive index: | 1.502 |
| Water Solubility: | Slightly soluble. 0.2 g/100 mL |
| Solubility: | Slightly soluble. 0.2 g/100 mL |
| Appearance: | White to tan crystalline powder |
| Packinggroup: | III |
| Color: | Minute crystals White, crystalline powder White to tan, crystalline solid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
