| Identification | |
| Name: | N-Acetylphenylhydrazine |
| Synonyms: | N'-PHENYLACETOHYDRAZIDE; N-ACETYLHYDRAZINOBENZENE; N-ACETYL-N'-PHENYLHYDRAZINE; PHENYLACETOHYDRAZIDE; 1-acetyl-2-phenylhydrazide; 1-Phenyl-2-acetylhydrazine; Acetic acid phenylhydrazone; 1-Acetyl-2-phenylhydrazine; 2-Phenylacetohydrazide |
| CAS: | 114-83-0 |
| EINECS: | 204-055-3 |
| Molecular Formula: | C8H10N2O |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C8H10N2O/c1-7(11)9-10-8-5-3-2-4-6-8/h2-6,10H,1H3,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 214.1°Cat760mmHg |
| Boiling Point: | 214.1°Cat760mmHg |
| Density: | 1.143g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | <0.1 g/100 mL at 19 C |
| Solubility: | Slightly soluble |
| Appearance: | Colorless prisms or white solid. |
| Specification: | white to light yellow crystal powde Safety Statements:22-26-36-24/25 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| HS Code: | 29280090 |
| Flash Point: | 214.1°Cat760mmHg |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | Hexagonal prisms |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
