| Identification | |
| Name: | Pyrimidine,2-(chloromethyl)-4,6-dimethoxy- |
| Synonyms: | 2-(Chloromethyl)-4,6-dimethoxypyrimidine; |
| CAS: | 114108-86-0 |
| Molecular Formula: | C7H9ClN2O2 |
| Molecular Weight: | 188.61 |
| InChI: | InChI=1/C7H9ClN2O2/c1-11-6-3-7(12-2)10-5(4-8)9-6/h3H,4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 39-42 |
| Flash Point: | 117.7°C |
| Boiling Point: | 271°Cat760mmHg |
| Density: | 1.244g/cm3 |
| Refractive index: | 1.513 |
| Appearance: | white powder |
| Specification: |
2-Chloromethyl-4,6-dimethoxypyrimidine ,with CAS number of 114108-86-0,can be called pyrimidine, 2-(chloromethyl)-4,6-dimethoxy- .It is a white powder,the usage of 2-Chloromethyl-4,6-dimethoxypyrimidine (CAS NO.114108-86-0) isan intermediate for life science products. |
| Flash Point: | 117.7°C |
| Usage: | Intermediate fr life science products Attributes For further information please contact us Contact |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
T: Toxic
|
 |
|
