| Identification |
| Name: | Naphthalene-1,2,3,4,5,6,7,8-d8 |
| Synonyms: | Naphthalene-d8(6CI,8CI,9CI); Naphthalene (C10D8); Octadeuterionaphthalene;Octadeuteronaphthalene; Perdeuterated naphthalene; Perdeuterionaphthalene;Perdeuteronaphthalene |
| CAS: | 1146-65-2 |
| EINECS: | 214-552-7 |
| Molecular Formula: | C10D8 |
| Molecular Weight: | 136.22 |
| InChI: | InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1334 4.1/PG 3 |
| Melting Point: | 80-82 °C(lit.)
|
| Flash Point: | 78 C |
| Boiling Point: | 218 °C(lit.)
|
| Density: | 4.4 (vs air) |
| Stability: | Stable. Incompatible with oxidizing agents. Flammable. |
| Refractive index: | 1.632 |
| Water Solubility: | Stability Stable. Incompatible with oxidizing agents. Flammable.Toxicology Carcinogen. Toxic. Long-term contact with the vapour maycause serious and permanent eye damage. May act as an allergen. |
| Solubility: | |
| Appearance: | white crystals |
| Packinggroup: | III |
| Flash Point: | 78 C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
