| Identification |
| Name: | 3H-Imidazo[4,5-f]quinoxaline,3,8-dimethyl-2-nitro- |
| Synonyms: | 3H-Imidazo(4,5-F)quinoxaline, 3,8-dimethyl-2-nitro- |
| CAS: | 115044-40-1 |
| Molecular Formula: | C11H9 N5 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H9N5O2/c1-6-5-12-7-3-4-8-10(9(7)13-6)14-11(15(8)2)16(17)18/h3-5H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 253.7°C |
| Boiling Point: | 495.9°C at 760 mmHg |
| Density: | 1.59g/cm3 |
| Refractive index: | 1.778 |
| Flash Point: | 253.7°C |
| Usage: | IQ-type carcinogens found in cooked food are biotransformed and bind to DNA through sequential N2-hydroxylation and O-esterification. The 2-nitro analoges may serve as an intermediate in the chemical synthesis to the metabolites. The metabolites |
| Safety Data |
| |
 |
