Identification |
Name: | 3H-Imidazo[4,5-f]quinoxaline,3,8-dimethyl-2-nitro- |
Synonyms: | 3H-Imidazo(4,5-F)quinoxaline, 3,8-dimethyl-2-nitro- |
CAS: | 115044-40-1 |
Molecular Formula: | C11H9 N5 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C11H9N5O2/c1-6-5-12-7-3-4-8-10(9(7)13-6)14-11(15(8)2)16(17)18/h3-5H,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 253.7°C |
Boiling Point: | 495.9°C at 760 mmHg |
Density: | 1.59g/cm3 |
Refractive index: | 1.778 |
Flash Point: | 253.7°C |
Usage: | IQ-type carcinogens found in cooked food are biotransformed and bind to DNA through sequential N2-hydroxylation and O-esterification. The 2-nitro analoges may serve as an intermediate in the chemical synthesis to the metabolites. The metabolites |
Safety Data |
|
 |