Identification |
Name: | 2-Pyrazinecarboxamide,3-amino-N-(aminoiminomethyl)-6-chloro-5-[ethyl(1-methylethyl)amino]- |
Synonyms: | Pyrazinecarboxamide,3-amino-N-(aminoiminomethyl)-6-chloro-5-[ethyl(1-methylethyl)amino]- (9CI);Pyrazinecarboxamide, N-amidino-3-amino-6-chloro-5-(ethylisopropylamino)-(7CI,8CI); 5-(N-Ethyl-N-isopropyl)amiloride; EIPA; Ethylisopropylamiloride; L593754; MH 12-43 |
CAS: | 1154-25-2 |
Molecular Formula: | C11H18 Cl N7 O |
Molecular Weight: | 299.7599 |
InChI: | InChI=1/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
Molecular Structure: |
|
Properties |
Transport: | 2811 |
Melting Point: | 202-205 °C(lit.) |
Density: | 1.49 g/cm3 |
Refractive index: | 1.664 |
Appearance: | Off-white to yellow solid |
Packinggroup: | III |
Storage Temperature: | 2-8°C |
Usage: | Selective Na+/H+ antiporter inhibitor. Selectively enhances the excretion of sodium ions without causing an increase in excretion of potassium ions |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|