| Identification | |
| Name: | Benzenemethanamine,3-chloro-4-methoxy- |
| Synonyms: | (3-Chloro-4-methoxyphenyl)methanamine;3-Chloro-4-methoxybenzylamine;[[3-Chloro-4-methoxyphenyl]methyl]amine; |
| CAS: | 115514-77-7 |
| Molecular Formula: | C8H10ClNO |
| Molecular Weight: | 171.63 |
| InChI: | InChI=1/C8H10ClNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,5,10H2,1H3 |
| Molecular Structure: | ![(C8H10ClNO) (3-Chloro-4-methoxyphenyl)methanamine;3-Chloro-4-methoxybenzylamine;[[3-Chloro-4-methoxyphenyl]methy...](https://img1.guidechem.com/chem/e/dict/28/115514-77-7.jpg) |
| Properties | |
| Density: | 1.18 g/cm3 |
| Refractive index: | 1.549 |
| Specification: |
The 3-Chloro-4-methoxybenzenemethanamine with the cas number 115514-77-7 is also called Benzenemethanamine,3-chloro-4-methoxy-. The systematic name is 1-(3-chloro-4-methoxyphenyl)methanamine. Its molecular formula is C8H10ClNO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.55; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 12.47 Å2; (7)Index of Refraction: 1.549; (8)Molar Refractivity: 46.27 cm3; (9)Molar Volume: 145.3 cm3; (10)Polarizability: 18.34×10-24cm3; (11)Surface Tension: 40 dyne/cm; (12)Enthalpy of Vaporization: 50.14 kJ/mol; (13)Vapour Pressure: 0.0102 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
