| Identification | |
| Name: | Piperazine,1-(2,4-difluorophenyl)- |
| Synonyms: | 4-(2,4-Difluorophenyl)piperazine;N-(2,4-Difluorophenyl)piperazine; |
| CAS: | 115761-79-0 |
| Molecular Formula: | C10H12F2N2 |
| Molecular Weight: | 198.21 |
| InChI: | InChI=1/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/p+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2928 |
| Melting Point: | 74-76ºC |
| Density: | 1.192 g/cm3 |
| Appearance: | white crystals or crystalline powder |
| Specification: |
1-(2,4-Difluorophenyl)piperazine , with CAS number of 115761-79-0, can be called piperazine, 1-(2,4-difluorophenyl)- ; 1-(2,4-Difluorophenyl)piperazine 97% ; 3-fluoro-4-(trifluoromethyl)benzoic acid . It is a white crystal or crystalline powder. |
| Packinggroup: | II |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
