| Identification | |
| Name: | 4,4',4''-Trimethyltriphenylamine |
| Synonyms: | N,N,N-Tris(4-methylphenyl)amine;N,N-Bis(p-tolyl)-p-toluidine;Tri(4-methylphenyl)amine;Tri-4-tolylamine;Tris(4-methylphenyl)amine;Tris(4-tolyl)amine;Tris(p-methylphenyl)amine;Tris(p-tolyl)amine;Tritolylamine;Tri-p-tolylamine(7CI,8CI); |
| CAS: | 1159-53-1 |
| EINECS: | 214-595-1 |
| Molecular Formula: | C21H21N |
| Molecular Weight: | 287.4 |
| InChI: | InChI=1/C21H21N/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.066g/cm3 |
| Refractive index: | 1.619 |
| Appearance: | white crystal |
| Specification: |
4,4',4''-Trimethyltriphenylamine , its cas register number is 1159-53-1. It also can be called 4-methyl-n,n-bis(4-methylphenyl)-benzenamin ; 4,4',4''-trimethyltriphenylamine ; n,n-di-p-tolyl-p-toluidine ; tri-p-tolylamine ; tris(4-methylphenyl)amine ; tris(p-methylphenyl)amine ; tri(4-tolyl)amine ; benzenamine, 4-methyl-n,n-bis(4-methylphenyl)- and so on. |
| Safety Data | |
 |
|
